C13H10ClN3O — CID 81098637
[6-(5-chloro-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine (PubChem CID 81098637) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is [6-(5-chloro-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine.
| Compound Name | [6-(5-chloro-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81098637 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [6-(5-chloro-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(-c2nc3cc(Cl)ccc3o2)nc1 |
| InChI | InChI=1S/C13H10ClN3O/c14-9-2-4-12-11(5-9)17-13(18-12)10-3-1-8(6-15)7-16-10/h1-5,7H,6,15H2 |
| InChIKey | ZNFAWZHWYKMLKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |