C14H13N3O — CID 81098943
[6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine (PubChem CID 81098943) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is [6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine.
| Compound Name | [6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81098943 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
| SMILES | Cc1ccc2oc(-c3ccc(CN)cn3)nc2c1 |
| InChI | InChI=1S/C14H13N3O/c1-9-2-5-13-12(6-9)17-14(18-13)11-4-3-10(7-15)8-16-11/h2-6,8H,7,15H2,1H3 |
| InChIKey | CFNSCHDJGHNSAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |