About 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide
2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide (PubChem CID 91680221) has the molecular formula C21H17Br2FN2O
and a molecular weight of 492.19 g/mol. Its IUPAC name is 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide.
Molecular Properties
| Compound Name | 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide |
| PubChem CID | 91680221 |
| Molecular Formula | C21H17Br2FN2O |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide |
| SMILES | Cc1cc(C)c2oc(-c3cc(Br)c[n+](Cc4cccc(F)c4)c3)nc2c1.[Br-] |
| InChI | InChI=1S/C21H17BrFN2O.BrH/c1-13-6-14(2)20-19(7-13)24-21(26-20)16-9-17(22)12-25(11-16)10-15-4-3-5-18(23)8-15;/h3-9,11-12H,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BHXMZCVUCQWNSQ-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide?
The IUPAC name of 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide (CID 91680221) is 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide.
What is the SMILES notation for 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide?
The canonical SMILES for 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide is Cc1cc(C)c2oc(-c3cc(Br)c[n+](Cc4cccc(F)c4)c3)nc2c1.[Br-].
What is the InChIKey of 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide?
The InChIKey is BHXMZCVUCQWNSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H17BrFN2O.BrH/c1-13-6-14(2)20-19(7-13)24-21(26-20)16-9-17(22)12-25(11-16)10-15-4-3-5-18(23)8-15;/h3-9,11-12H,10H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide?
2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide has a molecular weight of 492.19 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,7-dimethyl-1,3-benzoxazole bromide is sourced from PubChem (CID 91680221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).