C21H17Br2FN2O — CID 91680219
2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,6-dimethyl-1,3-benzoxazole bromide (PubChem CID 91680219) has the molecular formula C21H17Br2FN2O and a molecular weight of 492.19 g/mol. Its IUPAC name is 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,6-dimethyl-1,3-benzoxazole bromide.
| Compound Name | 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,6-dimethyl-1,3-benzoxazole bromide |
|---|---|
| PubChem CID | 91680219 |
| Molecular Formula | C21H17Br2FN2O |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 2-[5-bromo-1-[(3-fluorophenyl)methyl]pyridin-1-ium-3-yl]-5,6-dimethyl-1,3-benzoxazole bromide |
| SMILES | Cc1cc2nc(-c3cc(Br)c[n+](Cc4cccc(F)c4)c3)oc2cc1C.[Br-] |
| InChI | InChI=1S/C21H17BrFN2O.BrH/c1-13-6-19-20(7-14(13)2)26-21(24-19)16-9-17(22)12-25(11-16)10-15-4-3-5-18(23)8-15;/h3-9,11-12H,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NRWXLPJXYWNDNV-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|