C14H7FN2O2 — CID 169354530
2-(3-fluorophenyl)-6-isocyanato-1,3-benzoxazole (PubChem CID 169354530) has the molecular formula C14H7FN2O2 and a molecular weight of 254.22 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-6-isocyanato-1,3-benzoxazole.
| Compound Name | 2-(3-fluorophenyl)-6-isocyanato-1,3-benzoxazole |
|---|---|
| PubChem CID | 169354530 |
| Molecular Formula | C14H7FN2O2 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(3-fluorophenyl)-6-isocyanato-1,3-benzoxazole |
| SMILES | O=C=Nc1ccc2nc(-c3cccc(F)c3)oc2c1 |
| InChI | InChI=1S/C14H7FN2O2/c15-10-3-1-2-9(6-10)14-17-12-5-4-11(16-8-18)7-13(12)19-14/h1-7H |
| InChIKey | ITCCXWYVAKARMZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|