C17H13FN2O2 — CID 4714601
N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]but-3-enamide (PubChem CID 4714601) has the molecular formula C17H13FN2O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]but-3-enamide.
| Compound Name | N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]but-3-enamide |
|---|---|
| PubChem CID | 4714601 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]but-3-enamide |
| SMILES | C=CCC(=O)Nc1ccc2oc(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C17H13FN2O2/c1-2-4-16(21)19-13-7-8-15-14(10-13)20-17(22-15)11-5-3-6-12(18)9-11/h2-3,5-10H,1,4H2,(H,19,21) |
| InChIKey | DMEYKVRYBYUOHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|