C14H10FN3OS — CID 28689369
[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]thiourea (PubChem CID 28689369) has the molecular formula C14H10FN3OS and a molecular weight of 287.32 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]thiourea.
| Compound Name | [2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]thiourea |
|---|---|
| PubChem CID | 28689369 |
| Molecular Formula | C14H10FN3OS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]thiourea |
| SMILES | NC(=S)Nc1ccc2oc(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C14H10FN3OS/c15-9-3-1-2-8(6-9)13-18-11-7-10(17-14(16)20)4-5-12(11)19-13/h1-7H,(H3,16,17,20) |
| InChIKey | SCNOVXICWGOVBJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|