C18H10N2O2 — CID 137169487
3-benzo[f][1,3]benzoxazol-2-yl-4-hydroxybenzonitrile (PubChem CID 137169487) has the molecular formula C18H10N2O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-benzo[f][1,3]benzoxazol-2-yl-4-hydroxybenzonitrile.
| Compound Name | 3-benzo[f][1,3]benzoxazol-2-yl-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 137169487 |
| Molecular Formula | C18H10N2O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-benzo[f][1,3]benzoxazol-2-yl-4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)c(-c2nc3cc4ccccc4cc3o2)c1 |
| InChI | InChI=1S/C18H10N2O2/c19-10-11-5-6-16(21)14(7-11)18-20-15-8-12-3-1-2-4-13(12)9-17(15)22-18/h1-9,21H |
| InChIKey | HLKOVMBUOQVPBA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |