C21H20NO5P — CID 137091436
2-benzo[f][1,3]benzoxazol-2-yl-4-(2-dimethoxyphosphorylethyl)phenol (PubChem CID 137091436) has the molecular formula C21H20NO5P and a molecular weight of 397.37 g/mol. Its IUPAC name is 2-benzo[f][1,3]benzoxazol-2-yl-4-(2-dimethoxyphosphorylethyl)phenol.
| Compound Name | 2-benzo[f][1,3]benzoxazol-2-yl-4-(2-dimethoxyphosphorylethyl)phenol |
|---|---|
| PubChem CID | 137091436 |
| Molecular Formula | C21H20NO5P |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-benzo[f][1,3]benzoxazol-2-yl-4-(2-dimethoxyphosphorylethyl)phenol |
| SMILES | COP(=O)(CCc1ccc(O)c(-c2nc3cc4ccccc4cc3o2)c1)OC |
| InChI | InChI=1S/C21H20NO5P/c1-25-28(24,26-2)10-9-14-7-8-19(23)17(11-14)21-22-18-12-15-5-3-4-6-16(15)13-20(18)27-21/h3-8,11-13,23H,9-10H2,1-2H3 |
| InChIKey | FQQHIGCQNNSANA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|