C23H19N3O5 — CID 4585781
2-ethoxy-6-[[4-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-nitrophenol (PubChem CID 4585781) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-ethoxy-6-[[4-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-ethoxy-6-[[4-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 4585781 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-ethoxy-6-[[4-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-nitrophenol |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N/c2ccc(-c3nc4c(C)cccc4o3)cc2)c1O |
| InChI | InChI=1S/C23H19N3O5/c1-3-30-20-12-18(26(28)29)11-16(22(20)27)13-24-17-9-7-15(8-10-17)23-25-21-14(2)5-4-6-19(21)31-23/h4-13,27H,3H2,1-2H3/b24-13+ |
| InChIKey | WIFNESGOFFRVRN-ZMOGYAJESA-N |
| XLogP | 5.57 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|