C29H20Cl2N2O3 — CID 3099604
[4-[[2-methyl-5-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] 2,5-dichlorobenzoate (PubChem CID 3099604) has the molecular formula C29H20Cl2N2O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is [4-[[2-methyl-5-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] 2,5-dichlorobenzoate.
| Compound Name | [4-[[2-methyl-5-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 3099604 |
| Molecular Formula | C29H20Cl2N2O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | [4-[[2-methyl-5-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] 2,5-dichlorobenzoate |
| SMILES | Cc1ccc(-c2nc3c(C)cccc3o2)cc1/N=C/c1ccc(OC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H20Cl2N2O3/c1-17-6-9-20(28-33-27-18(2)4-3-5-26(27)36-28)14-25(17)32-16-19-7-11-22(12-8-19)35-29(34)23-15-21(30)10-13-24(23)31/h3-16H,1-2H3/b32-16+ |
| InChIKey | WCJJSBWWXLXLPM-KPGMTVGESA-N |
| XLogP | 8.39 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|