C26H21NO2 — CID 4540846
[4-[(3,4-dimethylphenyl)iminomethyl]phenyl] naphthalene-1-carboxylate (PubChem CID 4540846) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 4540846 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] naphthalene-1-carboxylate |
| SMILES | Cc1ccc(/N=C/c2ccc(OC(=O)c3cccc4ccccc34)cc2)cc1C |
| InChI | InChI=1S/C26H21NO2/c1-18-10-13-22(16-19(18)2)27-17-20-11-14-23(15-12-20)29-26(28)25-9-5-7-21-6-3-4-8-24(21)25/h3-17H,1-2H3/b27-17+ |
| InChIKey | DVHZROCPVNJJMI-WPWMEQJKSA-N |
| XLogP | 6.43 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|