C27H20ClN3O4 — CID 6271935
[4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 6271935) has the molecular formula C27H20ClN3O4 and a molecular weight of 485.93 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6271935 |
| Molecular Formula | C27H20ClN3O4 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)N/N=C\c1ccc(OC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H20ClN3O4/c28-21-8-3-7-20(15-21)26(33)29-17-25(32)31-30-16-18-11-13-22(14-12-18)35-27(34)24-10-4-6-19-5-1-2-9-23(19)24/h1-16H,17H2,(H,29,33)(H,31,32)/b30-16- |
| InChIKey | ULRQDOZSFLWDKR-UHBFCERESA-N |
| XLogP | 4.59 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|