C48H33N3O9 — CID 171716142
tris[2-[(3-hydroxyphenyl)iminomethyl]phenyl] benzene-1,3,5-tricarboxylate (PubChem CID 171716142) has the molecular formula C48H33N3O9 and a molecular weight of 795.80 g/mol. Its IUPAC name is tris[2-[(3-hydroxyphenyl)iminomethyl]phenyl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[2-[(3-hydroxyphenyl)iminomethyl]phenyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 171716142 |
| Molecular Formula | C48H33N3O9 |
| Molecular Weight | 795.80 g/mol |
| Exact Mass | 795.22 |
| IUPAC Name | tris[2-[(3-hydroxyphenyl)iminomethyl]phenyl] benzene-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccccc1/C=N/c1cccc(O)c1)c1cc(C(=O)Oc2ccccc2/C=N/c2cccc(O)c2)cc(C(=O)Oc2ccccc2/C=N/c2cccc(O)c2)c1 |
| InChI | InChI=1S/C48H33N3O9/c52-40-16-7-13-37(25-40)49-28-31-10-1-4-19-43(31)58-46(55)34-22-35(47(56)59-44-20-5-2-11-32(44)29-50-38-14-8-17-41(53)26-38)24-36(23-34)48(57)60-45-21-6-3-12-33(45)30-51-39-15-9-18-42(54)27-39/h1-30,52-54H/b49-28+,50-29+,51-30+ |
| InChIKey | GEZWGRXLHWKVSF-HSRDIQCSSA-N |
| XLogP | 9.71 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.80 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|