C40H24N6O12S — CID 46501086
[2-[[4-[4-[[2-(3,5-dinitrobenzoyl)oxyphenyl]methylideneamino]phenyl]sulfanylphenyl]iminomethyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 46501086) has the molecular formula C40H24N6O12S and a molecular weight of 812.73 g/mol. Its IUPAC name is [2-[[4-[4-[[2-(3,5-dinitrobenzoyl)oxyphenyl]methylideneamino]phenyl]sulfanylphenyl]iminomethyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [2-[[4-[4-[[2-(3,5-dinitrobenzoyl)oxyphenyl]methylideneamino]phenyl]sulfanylphenyl]iminomethyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 46501086 |
| Molecular Formula | C40H24N6O12S |
| Molecular Weight | 812.73 g/mol |
| Exact Mass | 812.12 |
| IUPAC Name | [2-[[4-[4-[[2-(3,5-dinitrobenzoyl)oxyphenyl]methylideneamino]phenyl]sulfanylphenyl]iminomethyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | O=C(Oc1ccccc1/C=N/c1ccc(Sc2ccc(/N=C/c3ccccc3OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C40H24N6O12S/c47-39(27-17-31(43(49)50)21-32(18-27)44(51)52)57-37-7-3-1-5-25(37)23-41-29-9-13-35(14-10-29)59-36-15-11-30(12-16-36)42-24-26-6-2-4-8-38(26)58-40(48)28-19-33(45(53)54)22-34(20-28)46(55)56/h1-24H/b41-23+,42-24+ |
| InChIKey | GTYYTXVPLVJOLD-WAJJMWJGSA-N |
| XLogP | 9.41 |
| TPSA | 249.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.73 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|