C15H11N5O6S — CID 4129651
[2-[(carbamothioylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 4129651) has the molecular formula C15H11N5O6S and a molecular weight of 389.35 g/mol. Its IUPAC name is [2-[(carbamothioylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [2-[(carbamothioylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 4129651 |
| Molecular Formula | C15H11N5O6S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [2-[(carbamothioylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | NC(=S)NN=Cc1ccccc1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N5O6S/c16-15(27)18-17-8-9-3-1-2-4-13(9)26-14(21)10-5-11(19(22)23)7-12(6-10)20(24)25/h1-8H,(H3,16,18,27) |
| InChIKey | HBVDKNXNBUJPFY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 162.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|