C23H16Cl2N2O4 — CID 126413822
[2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126413822) has the molecular formula C23H16Cl2N2O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is [2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126413822 |
| Molecular Formula | C23H16Cl2N2O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | [2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccccc1C=NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl2N2O4/c24-15-7-8-16(17(25)10-15)23(30)31-18-4-2-1-3-14(18)11-26-27-21(28)19-12-5-6-13(9-12)20(19)22(27)29/h1-8,10-13,19-20H,9H2/t12-,13-,19-,20+/m0/s1 |
| InChIKey | PIYZTWMVIKVPPF-USEHDAJUSA-N |
| XLogP | 4.35 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|