C17H14Cl2N2O2 — CID 98068781
(1R,2R,6S,7R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 98068781) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98068781 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (1R,2R,6S,7R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1/N=C\c1ccc(Cl)cc1Cl)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-12-6-5-11(13(19)7-12)8-20-21-16(22)14-9-1-2-10(4-3-9)15(14)17(21)23/h1-2,5-10,14-15H,3-4H2/b20-8-/t9-,10-,14-,15+/m0/s1 |
| InChIKey | IMGRXSFQDPMUBV-XTOGYYLYSA-N |
| XLogP | 3.52 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|