C17H17ClN4O5 — CID 135957570
N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-methoxyanilino)propanamide (PubChem CID 135957570) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-methoxyanilino)propanamide.
| Compound Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 135957570 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-methoxyanilino)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)N/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C17H17ClN4O5/c1-10(20-13-3-5-14(27-2)6-4-13)17(24)21-19-9-11-7-12(18)8-15(16(11)23)22(25)26/h3-10,20,23H,1-2H3,(H,21,24)/b19-9+ |
| InChIKey | JPWBOVLKZOXINZ-DJKKODMXSA-N |
| XLogP | 2.91 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|