C17H17ClN4O4 — CID 135750371
(2S)-2-anilino-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]butanamide (PubChem CID 135750371) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is (2S)-2-anilino-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]butanamide.
| Compound Name | (2S)-2-anilino-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 135750371 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2S)-2-anilino-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]butanamide |
| SMILES | CC[C@H](Nc1ccccc1)C(=O)N/N=C\c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H17ClN4O4/c1-2-14(20-13-6-4-3-5-7-13)17(24)21-19-10-11-8-12(18)9-15(16(11)23)22(25)26/h3-10,14,20,23H,2H2,1H3,(H,21,24)/b19-10-/t14-/m0/s1 |
| InChIKey | DFWMESZWXBRBBP-VAODSVERSA-N |
| XLogP | 3.29 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|