C15H16ClN3OS2 — CID 19228860
(E)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)prop-2-enamide (PubChem CID 19228860) has the molecular formula C15H16ClN3OS2 and a molecular weight of 353.90 g/mol. Its IUPAC name is (E)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19228860 |
| Molecular Formula | C15H16ClN3OS2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | (E)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)prop-2-enamide |
| SMILES | CCCCSc1nnc(NC(=O)/C=C/c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C15H16ClN3OS2/c1-2-3-9-21-15-19-18-14(22-15)17-13(20)8-7-11-5-4-6-12(16)10-11/h4-8,10H,2-3,9H2,1H3,(H,17,18,20)/b8-7+ |
| InChIKey | GNNPUMDGIAMTOI-BQYQJAHWSA-N |
| XLogP | 4.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|