C12H10ClF3N2OS2 — CID 71848811
N-[3-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 71848811) has the molecular formula C12H10ClF3N2OS2 and a molecular weight of 354.81 g/mol. Its IUPAC name is N-[3-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71848811 |
| Molecular Formula | C12H10ClF3N2OS2 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | N-[3-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCSc1nc2cc(Cl)ccc2s1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2OS2/c13-7-2-3-9-8(6-7)18-11(21-9)20-5-1-4-17-10(19)12(14,15)16/h2-3,6H,1,4-5H2,(H,17,19) |
| InChIKey | ZSJSWIGDFUOFGV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|