C14H16ClNO2S — CID 43470941
2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-ethylbutanoic acid (PubChem CID 43470941) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 43470941 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cc1nc2cc(Cl)ccc2s1)C(=O)O |
| InChI | InChI=1S/C14H16ClNO2S/c1-3-14(4-2,13(17)18)8-12-16-10-7-9(15)5-6-11(10)19-12/h5-7H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | AXTJEAYCITUTKU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |