C14H18N2O3S — CID 82193020
4-[(6-propan-2-yloxy-1,3-benzothiazol-2-yl)amino]butanoic acid (PubChem CID 82193020) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-[(6-propan-2-yloxy-1,3-benzothiazol-2-yl)amino]butanoic acid.
| Compound Name | 4-[(6-propan-2-yloxy-1,3-benzothiazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 82193020 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[(6-propan-2-yloxy-1,3-benzothiazol-2-yl)amino]butanoic acid |
| SMILES | CC(C)Oc1ccc2nc(NCCCC(=O)O)sc2c1 |
| InChI | InChI=1S/C14H18N2O3S/c1-9(2)19-10-5-6-11-12(8-10)20-14(16-11)15-7-3-4-13(17)18/h5-6,8-9H,3-4,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | SSSMVANPRQCUIX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|