C14H9BrF2N2S — CID 79527745
6-bromo-N-[(2,4-difluorophenyl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 79527745) has the molecular formula C14H9BrF2N2S and a molecular weight of 355.21 g/mol. Its IUPAC name is 6-bromo-N-[(2,4-difluorophenyl)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-[(2,4-difluorophenyl)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79527745 |
| Molecular Formula | C14H9BrF2N2S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 6-bromo-N-[(2,4-difluorophenyl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc(CNc2nc3ccc(Br)cc3s2)c(F)c1 |
| InChI | InChI=1S/C14H9BrF2N2S/c15-9-2-4-12-13(5-9)20-14(19-12)18-7-8-1-3-10(16)6-11(8)17/h1-6H,7H2,(H,18,19) |
| InChIKey | JTRXDEMVVFSHFP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |