C12H9FN2S2 — CID 79144448
6-fluoro-N-(thiophen-2-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 79144448) has the molecular formula C12H9FN2S2 and a molecular weight of 264.35 g/mol. Its IUPAC name is 6-fluoro-N-(thiophen-2-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-(thiophen-2-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79144448 |
| Molecular Formula | C12H9FN2S2 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 6-fluoro-N-(thiophen-2-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2nc(NCc3cccs3)sc2c1 |
| InChI | InChI=1S/C12H9FN2S2/c13-8-3-4-10-11(6-8)17-12(15-10)14-7-9-2-1-5-16-9/h1-6H,7H2,(H,14,15) |
| InChIKey | YNKPYWCJPDDADX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |