C18H18N2O5S2 — CID 56590326
dimethyl 2-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-thiophen-2-ylmethyl]propanedioate (PubChem CID 56590326) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is dimethyl 2-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-thiophen-2-ylmethyl]propanedioate.
| Compound Name | dimethyl 2-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-thiophen-2-ylmethyl]propanedioate |
|---|---|
| PubChem CID | 56590326 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | dimethyl 2-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-thiophen-2-ylmethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(Nc1nc2ccc(OC)cc2s1)c1cccs1 |
| InChI | InChI=1S/C18H18N2O5S2/c1-23-10-6-7-11-13(9-10)27-18(19-11)20-15(12-5-4-8-26-12)14(16(21)24-2)17(22)25-3/h4-9,14-15H,1-3H3,(H,19,20) |
| InChIKey | SKWXXJPQUBCQQE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|