C17H16N2O3S2 — CID 24666179
N-(6-methoxy-1,3-benzothiazol-2-yl)-5-oxo-5-thiophen-2-ylpentanamide (PubChem CID 24666179) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-5-oxo-5-thiophen-2-ylpentanamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-oxo-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 24666179 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-oxo-5-thiophen-2-ylpentanamide |
| SMILES | COc1ccc2nc(NC(=O)CCCC(=O)c3cccs3)sc2c1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-22-11-7-8-12-15(10-11)24-17(18-12)19-16(21)6-2-4-13(20)14-5-3-9-23-14/h3,5,7-10H,2,4,6H2,1H3,(H,18,19,21) |
| InChIKey | GKFMTIASNDZENI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |