C11H9ClN4O2S2 — CID 43316191
N-(2-amino-2-sulfanylideneethyl)-N'-(6-chloro-1,3-benzothiazol-2-yl)oxamide (PubChem CID 43316191) has the molecular formula C11H9ClN4O2S2 and a molecular weight of 328.81 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(6-chloro-1,3-benzothiazol-2-yl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(6-chloro-1,3-benzothiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 43316191 |
| Molecular Formula | C11H9ClN4O2S2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(6-chloro-1,3-benzothiazol-2-yl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H9ClN4O2S2/c12-5-1-2-6-7(3-5)20-11(15-6)16-10(18)9(17)14-4-8(13)19/h1-3H,4H2,(H2,13,19)(H,14,17)(H,15,16,18) |
| InChIKey | MGIHEDOWBSAJCM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|