C17H9ClF2N2O2S — CID 9046610
(E)-N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3,4-difluorophenyl)-4-oxobut-2-enamide (PubChem CID 9046610) has the molecular formula C17H9ClF2N2O2S and a molecular weight of 378.79 g/mol. Its IUPAC name is (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3,4-difluorophenyl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3,4-difluorophenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 9046610 |
| Molecular Formula | C17H9ClF2N2O2S |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-4-(3,4-difluorophenyl)-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)c1ccc(F)c(F)c1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H9ClF2N2O2S/c18-10-2-4-13-15(8-10)25-17(21-13)22-16(24)6-5-14(23)9-1-3-11(19)12(20)7-9/h1-8H,(H,21,22,24)/b6-5+ |
| InChIKey | SYNDYSCZKOGMPP-AATRIKPKSA-N |
| XLogP | 4.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|