C17H14N4O6S — CID 19214372
N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-methyl-3,5-dinitrobenzamide (PubChem CID 19214372) has the molecular formula C17H14N4O6S and a molecular weight of 402.39 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-methyl-3,5-dinitrobenzamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 19214372 |
| Molecular Formula | C17H14N4O6S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-methyl-3,5-dinitrobenzamide |
| SMILES | CCOc1cccc2sc(NC(=O)c3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C17H14N4O6S/c1-3-27-13-5-4-6-14-15(13)18-17(28-14)19-16(22)10-7-11(20(23)24)9(2)12(8-10)21(25)26/h4-8H,3H2,1-2H3,(H,18,19,22) |
| InChIKey | WPZWWDWCAYRMHG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|