C17H16BrN3O4S — CID 19234250
2-[(4-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-nitrophenyl)ethanone;hydrobromide (PubChem CID 19234250) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is 2-[(4-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-nitrophenyl)ethanone;hydrobromide.
| Compound Name | 2-[(4-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-nitrophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 19234250 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 2-[(4-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-nitrophenyl)ethanone;hydrobromide |
| SMILES | Br.CCOc1cccc2sc(NCC(=O)c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C17H15N3O4S.BrH/c1-2-24-14-4-3-5-15-16(14)19-17(25-15)18-10-13(21)11-6-8-12(9-7-11)20(22)23;/h3-9H,2,10H2,1H3,(H,18,19);1H |
| InChIKey | XOTSMLIAORTVPT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|