C17H16FN3O3S2 — CID 3594581
N-[6-[ethyl(methyl)sulfamoyl]-1,3-benzothiazol-2-yl]-4-fluorobenzamide (PubChem CID 3594581) has the molecular formula C17H16FN3O3S2 and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[6-[ethyl(methyl)sulfamoyl]-1,3-benzothiazol-2-yl]-4-fluorobenzamide.
| Compound Name | N-[6-[ethyl(methyl)sulfamoyl]-1,3-benzothiazol-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3594581 |
| Molecular Formula | C17H16FN3O3S2 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[6-[ethyl(methyl)sulfamoyl]-1,3-benzothiazol-2-yl]-4-fluorobenzamide |
| SMILES | CCN(C)S(=O)(=O)c1ccc2nc(NC(=O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C17H16FN3O3S2/c1-3-21(2)26(23,24)13-8-9-14-15(10-13)25-17(19-14)20-16(22)11-4-6-12(18)7-5-11/h4-10H,3H2,1-2H3,(H,19,20,22) |
| InChIKey | YHAFWLCNGPLJGG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |