C11H10NO4- — CID 54715397
2-(3-carboxyprop-2-enoylamino)-4-methylphenolate (PubChem CID 54715397) has the molecular formula C11H10NO4- and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-(3-carboxyprop-2-enoylamino)-4-methylphenolate.
| Compound Name | 2-(3-carboxyprop-2-enoylamino)-4-methylphenolate |
|---|---|
| PubChem CID | 54715397 |
| Molecular Formula | C11H10NO4- |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-(3-carboxyprop-2-enoylamino)-4-methylphenolate |
| SMILES | Cc1ccc([O-])c(NC(=O)C=CC(=O)O)c1 |
| InChI | InChI=1S/C11H11NO4/c1-7-2-3-9(13)8(6-7)12-10(14)4-5-11(15)16/h2-6,13H,1H3,(H,12,14)(H,15,16)/p-1 |
| InChIKey | RSJIKWWWSZKTRO-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|