C27H42N2O2 — CID 123262993
piperazin-1-ylmethyl docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 123262993) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is piperazin-1-ylmethyl docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | piperazin-1-ylmethyl docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 123262993 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | piperazin-1-ylmethyl docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCN1CCNCC1 |
| InChI | InChI=1S/C27H42N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(30)31-26-29-24-22-28-23-25-29/h3-4,6-7,9-10,12-13,15-16,18-19,28H,2,5,8,11,14,17,20-26H2,1H3 |
| InChIKey | JGUIWEKGECRZLJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|