C12H21N3O3 — CID 101277455
(E)-4-[2-[2-[[(E)-but-1-enyl]amino]ethylamino]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 101277455) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (E)-4-[2-[2-[[(E)-but-1-enyl]amino]ethylamino]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[2-[[(E)-but-1-enyl]amino]ethylamino]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 101277455 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (E)-4-[2-[2-[[(E)-but-1-enyl]amino]ethylamino]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CC/C=C/NCCNCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H21N3O3/c1-2-3-6-13-7-8-14-9-10-15-11(16)4-5-12(17)18/h3-6,13-14H,2,7-10H2,1H3,(H,15,16)(H,17,18)/b5-4+,6-3+ |
| InChIKey | MTBHCDBDUHSXRQ-UTTVJGTNSA-N |
| XLogP | -0.15 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|