C13H24N4O3 — CID 101277476
(E)-4-oxo-4-[2-[2-[2-[[(E)-prop-1-enyl]amino]ethylamino]ethylamino]ethylamino]but-2-enoic acid (PubChem CID 101277476) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-[2-[2-[[(E)-prop-1-enyl]amino]ethylamino]ethylamino]ethylamino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[2-[2-[2-[[(E)-prop-1-enyl]amino]ethylamino]ethylamino]ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 101277476 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (E)-4-oxo-4-[2-[2-[2-[[(E)-prop-1-enyl]amino]ethylamino]ethylamino]ethylamino]but-2-enoic acid |
| SMILES | C/C=C/NCCNCCNCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H24N4O3/c1-2-5-14-6-7-15-8-9-16-10-11-17-12(18)3-4-13(19)20/h2-5,14-16H,6-11H2,1H3,(H,17,18)(H,19,20)/b4-3+,5-2+ |
| InChIKey | PRZISGIJRBLRLK-JWVZGZSZSA-N |
| XLogP | -0.95 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|