C9H14N2O5 — CID 163282832
(Z)-4-[2-(2-carboxyethylamino)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 163282832) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is (Z)-4-[2-(2-carboxyethylamino)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-(2-carboxyethylamino)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 163282832 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (Z)-4-[2-(2-carboxyethylamino)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)NCCNCCC(=O)O |
| InChI | InChI=1S/C9H14N2O5/c12-7(1-2-8(13)14)11-6-5-10-4-3-9(15)16/h1-2,10H,3-6H2,(H,11,12)(H,13,14)(H,15,16)/b2-1- |
| InChIKey | VYXXGKILKMMLFM-UPHRSURJSA-N |
| XLogP | -1.19 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|