C23H43N3O3 — CID 101285722
(E)-N-[2-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide (PubChem CID 101285722) has the molecular formula C23H43N3O3 and a molecular weight of 409.62 g/mol. Its IUPAC name is (E)-N-[2-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide.
| Compound Name | (E)-N-[2-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide |
|---|---|
| PubChem CID | 101285722 |
| Molecular Formula | C23H43N3O3 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (E)-N-[2-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]ethyl]oct-3-enamide |
| SMILES | CCCC/C=C/CC(=O)NCCN(CCNC(=O)C/C=C/CCCC)CC(C)O |
| InChI | InChI=1S/C23H43N3O3/c1-4-6-8-10-12-14-22(28)24-16-18-26(20-21(3)27)19-17-25-23(29)15-13-11-9-7-5-2/h10-13,21,27H,4-9,14-20H2,1-3H3,(H,24,28)(H,25,29)/b12-10+,13-11+ |
| InChIKey | LRWPICZGWANDDL-DCIPZJNNSA-N |
| XLogP | 3.17 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|