C32H58CaN4O8 — CID 101286611
calcium;3-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]propanoic acid;3-[2-hydroxypropyl-[2-[[(E)-1-oxidooct-3-enylidene]amino]ethyl]amino]propanoate (PubChem CID 101286611) has the molecular formula C32H58CaN4O8 and a molecular weight of 666.91 g/mol. Its IUPAC name is calcium;3-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]propanoic acid;3-[2-hydroxypropyl-[2-[[(E)-1-oxidooct-3-enylidene]amino]ethyl]amino]propanoate.
| Compound Name | calcium;3-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]propanoic acid;3-[2-hydroxypropyl-[2-[[(E)-1-oxidooct-3-enylidene]amino]ethyl]amino]propanoate |
|---|---|
| PubChem CID | 101286611 |
| Molecular Formula | C32H58CaN4O8 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | calcium;3-[2-hydroxypropyl-[2-[[(E)-oct-3-enoyl]amino]ethyl]amino]propanoic acid;3-[2-hydroxypropyl-[2-[[(E)-1-oxidooct-3-enylidene]amino]ethyl]amino]propanoate |
| SMILES | CCCC/C=C/C/C([O-])=N/CCN(CCC(=O)[O-])CC(C)O.CCCC/C=C/CC(=O)NCCN(CCC(=O)O)CC(C)O.[Ca+2] |
| InChI | InChI=1S/2C16H30N2O4.Ca/c2*1-3-4-5-6-7-8-15(20)17-10-12-18(13-14(2)19)11-9-16(21)22;/h2*6-7,14,19H,3-5,8-13H2,1-2H3,(H,17,20)(H,21,22);/q;;+2/p-2/b2*7-6+; |
| InChIKey | LJGVTLFWWPXLHB-RWUXNGIBSA-L |
| XLogP | 0.72 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|