C16H27NO3 — CID 88736405
(E)-N,N-bis(oxiran-2-ylmethyl)dec-2-enamide (PubChem CID 88736405) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (E)-N,N-bis(oxiran-2-ylmethyl)dec-2-enamide.
| Compound Name | (E)-N,N-bis(oxiran-2-ylmethyl)dec-2-enamide |
|---|---|
| PubChem CID | 88736405 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (E)-N,N-bis(oxiran-2-ylmethyl)dec-2-enamide |
| SMILES | CCCCCCC/C=C/C(=O)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C16H27NO3/c1-2-3-4-5-6-7-8-9-16(18)17(10-14-12-19-14)11-15-13-20-15/h8-9,14-15H,2-7,10-13H2,1H3/b9-8+ |
| InChIKey | OSIYOMRZTYQGHC-CMDGGOBGSA-N |
| XLogP | 2.53 |
| TPSA | 45.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|