C13H20N2O5 — CID 21422545
1,1,3,3-tetrakis(oxiran-2-ylmethyl)urea (PubChem CID 21422545) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(oxiran-2-ylmethyl)urea.
| Compound Name | 1,1,3,3-tetrakis(oxiran-2-ylmethyl)urea |
|---|---|
| PubChem CID | 21422545 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1,1,3,3-tetrakis(oxiran-2-ylmethyl)urea |
| SMILES | O=C(N(CC1CO1)CC1CO1)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C13H20N2O5/c16-13(14(1-9-5-17-9)2-10-6-18-10)15(3-11-7-19-11)4-12-8-20-12/h9-12H,1-8H2 |
| InChIKey | XOQCINMUEFCOPA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|