C9H12ClNO3 — CID 88735319
2-chloro-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide (PubChem CID 88735319) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is 2-chloro-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide.
| Compound Name | 2-chloro-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 88735319 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-chloro-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C9H12ClNO3/c1-6(10)9(12)11(2-7-4-13-7)3-8-5-14-8/h7-8H,1-5H2 |
| InChIKey | FLUHPKQITFOOBC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 45.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|