About oxiran-2-ylmethoxy carbonochloridate
oxiran-2-ylmethoxy carbonochloridate (PubChem CID 87599534) has the molecular formula C4H5ClO4
and a molecular weight of 152.53 g/mol. Its IUPAC name is oxiran-2-ylmethoxy carbonochloridate.
Molecular Properties
| Compound Name | oxiran-2-ylmethoxy carbonochloridate |
| PubChem CID | 87599534 |
| Molecular Formula | C4H5ClO4 |
| Molecular Weight | 152.53 g/mol |
| Exact Mass | 151.99 |
| IUPAC Name | oxiran-2-ylmethoxy carbonochloridate |
| SMILES | O=C(Cl)OOCC1CO1 |
| InChI | InChI=1S/C4H5ClO4/c5-4(6)9-8-2-3-1-7-3/h3H,1-2H2 |
| InChIKey | JLXZJKNZTQLSEG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethoxy carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethoxy carbonochloridate?
The IUPAC name of oxiran-2-ylmethoxy carbonochloridate (CID 87599534) is oxiran-2-ylmethoxy carbonochloridate.
What is the SMILES notation for oxiran-2-ylmethoxy carbonochloridate?
The canonical SMILES for oxiran-2-ylmethoxy carbonochloridate is O=C(Cl)OOCC1CO1.
What is the InChIKey of oxiran-2-ylmethoxy carbonochloridate?
The InChIKey is JLXZJKNZTQLSEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO4/c5-4(6)9-8-2-3-1-7-3/h3H,1-2H2.
What are the key properties of oxiran-2-ylmethoxy carbonochloridate?
oxiran-2-ylmethoxy carbonochloridate has a molecular weight of 152.53 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethoxy carbonochloridate is sourced from PubChem (CID 87599534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).