C10H17N3O3 — CID 175551525
1,1,2-tris(oxiran-2-ylmethyl)guanidine (PubChem CID 175551525) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1,1,2-tris(oxiran-2-ylmethyl)guanidine.
| Compound Name | 1,1,2-tris(oxiran-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 175551525 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1,1,2-tris(oxiran-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CO1)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C10H17N3O3/c11-10(12-1-7-4-14-7)13(2-8-5-15-8)3-9-6-16-9/h7-9H,1-6H2,(H2,11,12) |
| InChIKey | MNISIARTDKWFDK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|