C13H21N3O4 — CID 54239187
1,1,3,3-tetrakis(oxiran-2-ylmethyl)guanidine (PubChem CID 54239187) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(oxiran-2-ylmethyl)guanidine.
| Compound Name | 1,1,3,3-tetrakis(oxiran-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 54239187 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1,1,3,3-tetrakis(oxiran-2-ylmethyl)guanidine |
| SMILES | [H]N=C(N(CC1CO1)CC1CO1)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C13H21N3O4/c14-13(15(1-9-5-17-9)2-10-6-18-10)16(3-11-7-19-11)4-12-8-20-12/h9-12,14H,1-8H2 |
| InChIKey | QOUDBKVSLANHSI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|