C18H36N2O2 — CID 101274790
(E)-N-[2-(8-hydroxyoctylamino)ethyl]oct-4-enamide (PubChem CID 101274790) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (E)-N-[2-(8-hydroxyoctylamino)ethyl]oct-4-enamide.
| Compound Name | (E)-N-[2-(8-hydroxyoctylamino)ethyl]oct-4-enamide |
|---|---|
| PubChem CID | 101274790 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (E)-N-[2-(8-hydroxyoctylamino)ethyl]oct-4-enamide |
| SMILES | CCC/C=C/CCC(=O)NCCNCCCCCCCCO |
| InChI | InChI=1S/C18H36N2O2/c1-2-3-4-7-10-13-18(22)20-16-15-19-14-11-8-5-6-9-12-17-21/h4,7,19,21H,2-3,5-6,8-17H2,1H3,(H,20,22)/b7-4+ |
| InChIKey | NYKBEEXMUIGAKO-QPJJXVBHSA-N |
| XLogP | 3.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|