C17H31NO4 — CID 6424610
heptyl 3-methyl-2-(prop-2-enoxycarbonylamino)pentanoate (PubChem CID 6424610) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is heptyl 3-methyl-2-(prop-2-enoxycarbonylamino)pentanoate.
| Compound Name | heptyl 3-methyl-2-(prop-2-enoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 6424610 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | heptyl 3-methyl-2-(prop-2-enoxycarbonylamino)pentanoate |
| SMILES | C=CCOC(=O)NC(C(=O)OCCCCCCC)C(C)CC |
| InChI | InChI=1S/C17H31NO4/c1-5-8-9-10-11-13-21-16(19)15(14(4)7-3)18-17(20)22-12-6-2/h6,14-15H,2,5,7-13H2,1,3-4H3,(H,18,20) |
| InChIKey | QWYRFWHZBBSKCS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|