C21H30BrNO3 — CID 6425548
undec-10-enyl 2-[(2-bromobenzoyl)amino]propanoate (PubChem CID 6425548) has the molecular formula C21H30BrNO3 and a molecular weight of 424.38 g/mol. Its IUPAC name is undec-10-enyl 2-[(2-bromobenzoyl)amino]propanoate.
| Compound Name | undec-10-enyl 2-[(2-bromobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 6425548 |
| Molecular Formula | C21H30BrNO3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | undec-10-enyl 2-[(2-bromobenzoyl)amino]propanoate |
| SMILES | C=CCCCCCCCCCOC(=O)C(C)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C21H30BrNO3/c1-3-4-5-6-7-8-9-10-13-16-26-21(25)17(2)23-20(24)18-14-11-12-15-19(18)22/h3,11-12,14-15,17H,1,4-10,13,16H2,2H3,(H,23,24) |
| InChIKey | NNDYEGALJATJGB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|