C18H29NO4 — CID 91727365
heptyl 2-(furan-2-carbonylamino)-4-methylpentanoate (PubChem CID 91727365) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is heptyl 2-(furan-2-carbonylamino)-4-methylpentanoate.
| Compound Name | heptyl 2-(furan-2-carbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 91727365 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | heptyl 2-(furan-2-carbonylamino)-4-methylpentanoate |
| SMILES | CCCCCCCOC(=O)C(CC(C)C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H29NO4/c1-4-5-6-7-8-11-23-18(21)15(13-14(2)3)19-17(20)16-10-9-12-22-16/h9-10,12,14-15H,4-8,11,13H2,1-3H3,(H,19,20) |
| InChIKey | TYKKLNNFHFXVKU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|